C29H31N — CID 144628219
1-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-methyl-2-(2-methylphenyl)indole (PubChem CID 144628219) has the molecular formula C29H31N and a molecular weight of 393.57 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-methyl-2-(2-methylphenyl)indole.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-methyl-2-(2-methylphenyl)indole |
|---|---|
| PubChem CID | 144628219 |
| Molecular Formula | C29H31N |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-3-methyl-2-(2-methylphenyl)indole |
| SMILES | C/C=C\C(=C/CC)c1ccc2c(C)c(-c3ccccc3C)n(C3C=CC=CC3)c2c1 |
| InChI | InChI=1S/C29H31N/c1-5-12-23(13-6-2)24-18-19-27-22(4)29(26-17-11-10-14-21(26)3)30(28(27)20-24)25-15-8-7-9-16-25/h5,7-15,17-20,25H,6,16H2,1-4H3/b12-5-,23-13+ |
| InChIKey | CYRJMLDOPDBTPG-YMSYEBBISA-N |
| XLogP | 8.35 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|