About 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane
7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane (PubChem CID 144628448) has the molecular formula C18H26BrF2NOS
and a molecular weight of 422.38 g/mol. Its IUPAC name is 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane.
Molecular Properties
| Compound Name | 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane |
| PubChem CID | 144628448 |
| Molecular Formula | C18H26BrF2NOS |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane |
| SMILES | CCCCCC(F)(F)CC.CCc1cc2c(=O)n(C)cc(Br)c2s1 |
| InChI | InChI=1S/C10H10BrNOS.C8H16F2/c1-3-6-4-7-9(14-6)8(11)5-12(2)10(7)13;1-3-5-6-7-8(9,10)4-2/h4-5H,3H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | GIUVEPDJFLTFRB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane?
The IUPAC name of 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane (CID 144628448) is 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane.
What is the SMILES notation for 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane?
The canonical SMILES for 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane is CCCCCC(F)(F)CC.CCc1cc2c(=O)n(C)cc(Br)c2s1.
What is the InChIKey of 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane?
The InChIKey is GIUVEPDJFLTFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNOS.C8H16F2/c1-3-6-4-7-9(14-6)8(11)5-12(2)10(7)13;1-3-5-6-7-8(9,10)4-2/h4-5H,3H2,1-2H3;3-7H2,1-2H3.
What are the key properties of 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane?
7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane has a molecular weight of 422.38 g/mol, XLogP of 6.54, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-ethyl-5-methylthieno[3,2-c]pyridin-4-one;3,3-difluorooctane is sourced from PubChem (CID 144628448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).