About ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine
ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine (PubChem CID 144628619) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine |
| PubChem CID | 144628619 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine |
| SMILES | C/C=C(\C=N/C(C)N(C)C)CC.CC |
| InChI | InChI=1S/C10H20N2.C2H6/c1-6-10(7-2)8-11-9(3)12(4)5;1-2/h6,8-9H,7H2,1-5H3;1-2H3/b10-6-,11-8-; |
| InChIKey | NYGPASUOMIBWFS-TXBDWLMNSA-N |
| XLogP | 3.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine?
The IUPAC name of ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine (CID 144628619) is ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine.
What is the SMILES notation for ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine?
The canonical SMILES for ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine is C/C=C(\C=N/C(C)N(C)C)CC.CC.
What is the InChIKey of ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine?
The InChIKey is NYGPASUOMIBWFS-TXBDWLMNSA-N. The full InChI is InChI=1S/C10H20N2.C2H6/c1-6-10(7-2)8-11-9(3)12(4)5;1-2/h6,8-9H,7H2,1-5H3;1-2H3/b10-6-,11-8-;.
What are the key properties of ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine?
ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine has a molecular weight of 198.35 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine is sourced from PubChem (CID 144628619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).