C13H22N2 — CID 144628918
N'-(1,2,3,4,4a,8a-hexahydronaphthalen-1-ylmethyl)-N-methylmethanediamine (PubChem CID 144628918) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-(1,2,3,4,4a,8a-hexahydronaphthalen-1-ylmethyl)-N-methylmethanediamine.
| Compound Name | N'-(1,2,3,4,4a,8a-hexahydronaphthalen-1-ylmethyl)-N-methylmethanediamine |
|---|---|
| PubChem CID | 144628918 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-(1,2,3,4,4a,8a-hexahydronaphthalen-1-ylmethyl)-N-methylmethanediamine |
| SMILES | CNCNCC1CCCC2C=CC=CC21 |
| InChI | InChI=1S/C13H22N2/c1-14-10-15-9-12-7-4-6-11-5-2-3-8-13(11)12/h2-3,5,8,11-15H,4,6-7,9-10H2,1H3 |
| InChIKey | HHTSTOCMVCBRHZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|