About 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol
7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol (PubChem CID 144629236) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol |
| PubChem CID | 144629236 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CC(O)Cc2cc(CO)ccc21 |
| InChI | InChI=1S/C13H18O2/c1-13(2)7-11(15)6-10-5-9(8-14)3-4-12(10)13/h3-5,11,14-15H,6-8H2,1-2H3 |
| InChIKey | DTXGNFCAQWJONN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
The IUPAC name of 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol (CID 144629236) is 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol.
What is the SMILES notation for 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
The canonical SMILES for 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol is CC1(C)CC(O)Cc2cc(CO)ccc21.
What is the InChIKey of 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
The InChIKey is DTXGNFCAQWJONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-13(2)7-11(15)6-10-5-9(8-14)3-4-12(10)13/h3-5,11,14-15H,6-8H2,1-2H3.
What are the key properties of 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol?
7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol has a molecular weight of 206.28 g/mol, XLogP of 1.76, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-2-ol is sourced from PubChem (CID 144629236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).