C13H10ClFN4O — CID 144629350
5-N-[(3-chloro-5-fluorophenyl)methyl]-2,1,3-benzoxadiazole-4,5-diamine (PubChem CID 144629350) has the molecular formula C13H10ClFN4O and a molecular weight of 292.70 g/mol. Its IUPAC name is 5-N-[(3-chloro-5-fluorophenyl)methyl]-2,1,3-benzoxadiazole-4,5-diamine.
| Compound Name | 5-N-[(3-chloro-5-fluorophenyl)methyl]-2,1,3-benzoxadiazole-4,5-diamine |
|---|---|
| PubChem CID | 144629350 |
| Molecular Formula | C13H10ClFN4O |
| Molecular Weight | 292.70 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-N-[(3-chloro-5-fluorophenyl)methyl]-2,1,3-benzoxadiazole-4,5-diamine |
| SMILES | Nc1c(NCc2cc(F)cc(Cl)c2)ccc2nonc12 |
| InChI | InChI=1S/C13H10ClFN4O/c14-8-3-7(4-9(15)5-8)6-17-10-1-2-11-13(12(10)16)19-20-18-11/h1-5,17H,6,16H2 |
| InChIKey | HXUDXQNMSVPBNP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|