C27H31N5O2S2 — CID 144630684
1-[3-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]ethyl N'-methyl-N-(2-phenylacetyl)carbamimidothioate (PubChem CID 144630684) has the molecular formula C27H31N5O2S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 1-[3-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]ethyl N'-methyl-N-(2-phenylacetyl)carbamimidothioate.
| Compound Name | 1-[3-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]ethyl N'-methyl-N-(2-phenylacetyl)carbamimidothioate |
|---|---|
| PubChem CID | 144630684 |
| Molecular Formula | C27H31N5O2S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 1-[3-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]ethyl N'-methyl-N-(2-phenylacetyl)carbamimidothioate |
| SMILES | C/N=C(\NC(=O)Cc1ccccc1)SC(C)C1CCC(c2nnc(NC(=O)Cc3ccccc3)s2)C1 |
| InChI | InChI=1S/C27H31N5O2S2/c1-18(35-26(28-2)29-23(33)15-19-9-5-3-6-10-19)21-13-14-22(17-21)25-31-32-27(36-25)30-24(34)16-20-11-7-4-8-12-20/h3-12,18,21-22H,13-17H2,1-2H3,(H,28,29,33)(H,30,32,34) |
| InChIKey | XCFRJQLZIKFGGN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|