C19H26N6O3S3 — CID 144631056
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylphenyl)acetamide;1-methylsulfanyldiazirin-3-amine (PubChem CID 144631056) has the molecular formula C19H26N6O3S3 and a molecular weight of 482.66 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylphenyl)acetamide;1-methylsulfanyldiazirin-3-amine.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylphenyl)acetamide;1-methylsulfanyldiazirin-3-amine |
|---|---|
| PubChem CID | 144631056 |
| Molecular Formula | C19H26N6O3S3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylphenyl)acetamide;1-methylsulfanyldiazirin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)Nc2nnc(C3CCCCC3)s2)cc1.CSN1N=C1N |
| InChI | InChI=1S/C17H21N3O3S2.C2H5N3S/c1-25(22,23)14-9-7-12(8-10-14)11-15(21)18-17-20-19-16(24-17)13-5-3-2-4-6-13;1-6-5-2(3)4-5/h7-10,13H,2-6,11H2,1H3,(H,18,20,21);1H3,(H2,3,4) |
| InChIKey | JZQNDSRFLKQOIX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|