About 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one
1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one (PubChem CID 14463129) has the molecular formula C16H15NO5
and a molecular weight of 301.30 g/mol. Its IUPAC name is 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one.
Molecular Properties
| Compound Name | 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one |
| PubChem CID | 14463129 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one |
| SMILES | COc1cc2c(c(O)c1OC)c(=O)c1cccc(O)c1n2C |
| InChI | InChI=1S/C16H15NO5/c1-17-9-7-11(21-2)16(22-3)15(20)12(9)14(19)8-5-4-6-10(18)13(8)17/h4-7,18,20H,1-3H3 |
| InChIKey | WUPPOLDDVHCHKK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one?
The IUPAC name of 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one (CID 14463129) is 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one.
What is the SMILES notation for 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one?
The canonical SMILES for 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one is COc1cc2c(c(O)c1OC)c(=O)c1cccc(O)c1n2C.
What is the InChIKey of 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one?
The InChIKey is WUPPOLDDVHCHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO5/c1-17-9-7-11(21-2)16(22-3)15(20)12(9)14(19)8-5-4-6-10(18)13(8)17/h4-7,18,20H,1-3H3.
What are the key properties of 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one?
1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one has a molecular weight of 301.30 g/mol, XLogP of 2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydroxy-2,3-dimethoxy-10-methylacridin-9-one is sourced from PubChem (CID 14463129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).