C20H19NO4 — CID 14463134
6-hydroxy-11-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one (PubChem CID 14463134) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 6-hydroxy-11-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one.
| Compound Name | 6-hydroxy-11-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 14463134 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-hydroxy-11-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
| SMILES | COc1cccc2c(=O)c3c(O)cc4c(c3n(C)c12)C=CC(C)(C)O4 |
| InChI | InChI=1S/C20H19NO4/c1-20(2)9-8-11-15(25-20)10-13(22)16-18(11)21(3)17-12(19(16)23)6-5-7-14(17)24-4/h5-10,22H,1-4H3 |
| InChIKey | UNXDMEUOZWETRG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|