C21H29N3O3 — CID 144631431
2-[1-[(4-aminophenyl)methyl]-3,5-diethylpyrazol-4-yl]acetic acid;2,2-dimethylcyclopropan-1-one (PubChem CID 144631431) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[1-[(4-aminophenyl)methyl]-3,5-diethylpyrazol-4-yl]acetic acid;2,2-dimethylcyclopropan-1-one.
| Compound Name | 2-[1-[(4-aminophenyl)methyl]-3,5-diethylpyrazol-4-yl]acetic acid;2,2-dimethylcyclopropan-1-one |
|---|---|
| PubChem CID | 144631431 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[1-[(4-aminophenyl)methyl]-3,5-diethylpyrazol-4-yl]acetic acid;2,2-dimethylcyclopropan-1-one |
| SMILES | CC1(C)CC1=O.CCc1nn(Cc2ccc(N)cc2)c(CC)c1CC(=O)O |
| InChI | InChI=1S/C16H21N3O2.C5H8O/c1-3-14-13(9-16(20)21)15(4-2)19(18-14)10-11-5-7-12(17)8-6-11;1-5(2)3-4(5)6/h5-8H,3-4,9-10,17H2,1-2H3,(H,20,21);3H2,1-2H3 |
| InChIKey | MOFCPQLQGQZCFM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|