C22H28 — CID 144631897
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-methylnaphthalene;methane;prop-1-ene (PubChem CID 144631897) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-methylnaphthalene;methane;prop-1-ene.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-methylnaphthalene;methane;prop-1-ene |
|---|---|
| PubChem CID | 144631897 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-methylnaphthalene;methane;prop-1-ene |
| SMILES | C.C=C/C(=C\C=C/C)c1ccc2cc(C)ccc2c1.C=CC |
| InChI | InChI=1S/C18H18.C3H6.CH4/c1-4-6-7-15(5-2)17-11-10-16-12-14(3)8-9-18(16)13-17;1-3-2;/h4-13H,2H2,1,3H3;3H,1H2,2H3;1H4/b6-4-,15-7+;; |
| InChIKey | WJYKMPXYFMAHDS-NIGBQLDGSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|