About [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane
[(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane (PubChem CID 144632332) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane.
Molecular Properties
| Compound Name | [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane |
| PubChem CID | 144632332 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane |
| SMILES | CC.NC1CC/C=C\C(OC(=O)S)CC1 |
| InChI | InChI=1S/C9H15NO2S.C2H6/c10-7-3-1-2-4-8(6-5-7)12-9(11)13;1-2/h2,4,7-8H,1,3,5-6,10H2,(H,11,13);1-2H3/b4-2-; |
| InChIKey | GAJBCXGSGXXTQM-MKHFZPSSSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane?
The IUPAC name of [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane (CID 144632332) is [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane.
What is the SMILES notation for [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane?
The canonical SMILES for [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane is CC.NC1CC/C=C\C(OC(=O)S)CC1.
What is the InChIKey of [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane?
The InChIKey is GAJBCXGSGXXTQM-MKHFZPSSSA-N. The full InChI is InChI=1S/C9H15NO2S.C2H6/c10-7-3-1-2-4-8(6-5-7)12-9(11)13;1-2/h2,4,7-8H,1,3,5-6,10H2,(H,11,13);1-2H3/b4-2-;.
What are the key properties of [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane?
[(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane has a molecular weight of 231.36 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-6-aminocyclooct-2-en-1-yl]oxymethanethioic S-acid;ethane is sourced from PubChem (CID 144632332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).