C14H8F2N4O6 — CID 144632343
[5-[6-(3-fluorooxy-4,5-dihydroxyphenyl)-1,2,4,5-tetrazin-3-yl]-2,3-dihydroxyphenyl] hypofluorite (PubChem CID 144632343) has the molecular formula C14H8F2N4O6 and a molecular weight of 366.24 g/mol. Its IUPAC name is [5-[6-(3-fluorooxy-4,5-dihydroxyphenyl)-1,2,4,5-tetrazin-3-yl]-2,3-dihydroxyphenyl] hypofluorite.
| Compound Name | [5-[6-(3-fluorooxy-4,5-dihydroxyphenyl)-1,2,4,5-tetrazin-3-yl]-2,3-dihydroxyphenyl] hypofluorite |
|---|---|
| PubChem CID | 144632343 |
| Molecular Formula | C14H8F2N4O6 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [5-[6-(3-fluorooxy-4,5-dihydroxyphenyl)-1,2,4,5-tetrazin-3-yl]-2,3-dihydroxyphenyl] hypofluorite |
| SMILES | Oc1cc(-c2nnc(-c3cc(O)c(O)c(OF)c3)nn2)cc(OF)c1O |
| InChI | InChI=1S/C14H8F2N4O6/c15-25-9-3-5(1-7(21)11(9)23)13-17-19-14(20-18-13)6-2-8(22)12(24)10(4-6)26-16/h1-4,21-24H |
| InChIKey | JXNJBRUPPQIRAK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 150.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|