C26H33N3O2 — CID 144632463
1,3-dimethyl-5-[2-methyl-4-[[(1S)-2-[(2E,4Z)-5-methylnona-2,4,7-trien-2-yl]cyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one (PubChem CID 144632463) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1,3-dimethyl-5-[2-methyl-4-[[(1S)-2-[(2E,4Z)-5-methylnona-2,4,7-trien-2-yl]cyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one.
| Compound Name | 1,3-dimethyl-5-[2-methyl-4-[[(1S)-2-[(2E,4Z)-5-methylnona-2,4,7-trien-2-yl]cyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one |
|---|---|
| PubChem CID | 144632463 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1,3-dimethyl-5-[2-methyl-4-[[(1S)-2-[(2E,4Z)-5-methylnona-2,4,7-trien-2-yl]cyclopropyl]methoxy]pyrimidin-5-yl]pyridin-2-one |
| SMILES | CC=CC/C(C)=C\C=C(/C)C1C[C@@H]1COc1nc(C)ncc1-c1cc(C)c(=O)n(C)c1 |
| InChI | InChI=1S/C26H33N3O2/c1-7-8-9-17(2)10-11-18(3)23-13-22(23)16-31-25-24(14-27-20(5)28-25)21-12-19(4)26(30)29(6)15-21/h7-8,10-12,14-15,22-23H,9,13,16H2,1-6H3/b8-7?,17-10-,18-11+/t22-,23?/m1/s1 |
| InChIKey | LPLHITKGYUSXOV-IYEOYANPSA-N |
| XLogP | 5.33 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|