C19H22N4O4 — CID 144632511
4-[4-[(4R)-4-(5-methoxy-2-pyridinyl)pentoxy]-2-methylpyrimidin-5-yl]-2H-1,2-oxazol-5-one (PubChem CID 144632511) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[4-[(4R)-4-(5-methoxy-2-pyridinyl)pentoxy]-2-methylpyrimidin-5-yl]-2H-1,2-oxazol-5-one.
| Compound Name | 4-[4-[(4R)-4-(5-methoxy-2-pyridinyl)pentoxy]-2-methylpyrimidin-5-yl]-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 144632511 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[4-[(4R)-4-(5-methoxy-2-pyridinyl)pentoxy]-2-methylpyrimidin-5-yl]-2H-1,2-oxazol-5-one |
| SMILES | COc1ccc([C@H](C)CCCOc2nc(C)ncc2-c2c[nH]oc2=O)nc1 |
| InChI | InChI=1S/C19H22N4O4/c1-12(17-7-6-14(25-3)9-21-17)5-4-8-26-18-15(10-20-13(2)23-18)16-11-22-27-19(16)24/h6-7,9-12,22H,4-5,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | UQUPFRQGEZNJCV-GFCCVEGCSA-N |
| XLogP | 3.10 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|