About 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine
4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine (PubChem CID 144632553) has the molecular formula C22H23N3O4
and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine.
Molecular Properties
| Compound Name | 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine |
| PubChem CID | 144632553 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine |
| SMILES | COc1cccnc1.Cc1ncc(-c2ccc(C(=O)O)cc2)c(OCC2CC2)n1 |
| InChI | InChI=1S/C16H16N2O3.C6H7NO/c1-10-17-8-14(15(18-10)21-9-11-2-3-11)12-4-6-13(7-5-12)16(19)20;1-8-6-3-2-4-7-5-6/h4-8,11H,2-3,9H2,1H3,(H,19,20);2-5H,1H3 |
| InChIKey | TZYZDFBTPFTOLQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine?
The IUPAC name of 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine (CID 144632553) is 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine.
What is the SMILES notation for 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine?
The canonical SMILES for 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine is COc1cccnc1.Cc1ncc(-c2ccc(C(=O)O)cc2)c(OCC2CC2)n1.
What is the InChIKey of 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine?
The InChIKey is TZYZDFBTPFTOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3.C6H7NO/c1-10-17-8-14(15(18-10)21-9-11-2-3-11)12-4-6-13(7-5-12)16(19)20;1-8-6-3-2-4-7-5-6/h4-8,11H,2-3,9H2,1H3,(H,19,20);2-5H,1H3.
What are the key properties of 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine?
4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine has a molecular weight of 393.44 g/mol, XLogP of 4.03, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(cyclopropylmethoxy)-2-methylpyrimidin-5-yl]benzoic acid;3-methoxypyridine is sourced from PubChem (CID 144632553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).