About [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite
[5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite (PubChem CID 144632579) has the molecular formula C11H15FN2O3
and a molecular weight of 242.25 g/mol. Its IUPAC name is [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite.
Molecular Properties
| Compound Name | [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite |
| PubChem CID | 144632579 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite |
| SMILES | Cc1ncc(C2CCC(O)(O)CC2)c(OF)n1 |
| InChI | InChI=1S/C11H15FN2O3/c1-7-13-6-9(10(14-7)17-12)8-2-4-11(15,16)5-3-8/h6,8,15-16H,2-5H2,1H3 |
| InChIKey | UCOYLVGHEHHTQI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite?
The IUPAC name of [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite (CID 144632579) is [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite.
What is the SMILES notation for [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite?
The canonical SMILES for [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite is Cc1ncc(C2CCC(O)(O)CC2)c(OF)n1.
What is the InChIKey of [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite?
The InChIKey is UCOYLVGHEHHTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2O3/c1-7-13-6-9(10(14-7)17-12)8-2-4-11(15,16)5-3-8/h6,8,15-16H,2-5H2,1H3.
What are the key properties of [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite?
[5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite has a molecular weight of 242.25 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4,4-dihydroxycyclohexyl)-2-methylpyrimidin-4-yl] hypofluorite is sourced from PubChem (CID 144632579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).