C23H33N3O — CID 144632679
ethylcyclohexane;2-methyl-4-[[(2S)-2-(5-methyl-2-pyridinyl)cyclopropyl]methoxy]pyrimidine (PubChem CID 144632679) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is ethylcyclohexane;2-methyl-4-[[(2S)-2-(5-methyl-2-pyridinyl)cyclopropyl]methoxy]pyrimidine.
| Compound Name | ethylcyclohexane;2-methyl-4-[[(2S)-2-(5-methyl-2-pyridinyl)cyclopropyl]methoxy]pyrimidine |
|---|---|
| PubChem CID | 144632679 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | ethylcyclohexane;2-methyl-4-[[(2S)-2-(5-methyl-2-pyridinyl)cyclopropyl]methoxy]pyrimidine |
| SMILES | CCC1CCCCC1.Cc1ccc([C@H]2CC2COc2ccnc(C)n2)nc1 |
| InChI | InChI=1S/C15H17N3O.C8H16/c1-10-3-4-14(17-8-10)13-7-12(13)9-19-15-5-6-16-11(2)18-15;1-2-8-6-4-3-5-7-8/h3-6,8,12-13H,7,9H2,1-2H3;8H,2-7H2,1H3/t12?,13-;/m0./s1 |
| InChIKey | ZSCLCHITARCDEH-ZEDZUCNESA-N |
| XLogP | 5.65 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |