C20H25N3O2 — CID 144632685
cyclobutene;4-[[2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]-2,5-dimethylpyrimidine (PubChem CID 144632685) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is cyclobutene;4-[[2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]-2,5-dimethylpyrimidine.
| Compound Name | cyclobutene;4-[[2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]-2,5-dimethylpyrimidine |
|---|---|
| PubChem CID | 144632685 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | cyclobutene;4-[[2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]-2,5-dimethylpyrimidine |
| SMILES | C1=CCC1.COc1ccc(C2CC2COc2nc(C)ncc2C)nc1 |
| InChI | InChI=1S/C16H19N3O2.C4H6/c1-10-7-17-11(2)19-16(10)21-9-12-6-14(12)15-5-4-13(20-3)8-18-15;1-2-4-3-1/h4-5,7-8,12,14H,6,9H2,1-3H3;1-2H,3-4H2 |
| InChIKey | OJSAYTMVCVHBFV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|