C8H12BrN3 — CID 144632858
6-bromo-2-propan-2-ylpyridine-3,4-diamine (PubChem CID 144632858) has the molecular formula C8H12BrN3 and a molecular weight of 230.11 g/mol. Its IUPAC name is 6-bromo-2-propan-2-ylpyridine-3,4-diamine.
| Compound Name | 6-bromo-2-propan-2-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 144632858 |
| Molecular Formula | C8H12BrN3 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 6-bromo-2-propan-2-ylpyridine-3,4-diamine |
| SMILES | CC(C)c1nc(Br)cc(N)c1N |
| InChI | InChI=1S/C8H12BrN3/c1-4(2)8-7(11)5(10)3-6(9)12-8/h3-4H,11H2,1-2H3,(H2,10,12) |
| InChIKey | FSLFOJYHCNYWQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|