About 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene
3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene (PubChem CID 144633088) has the molecular formula C23H40O3
and a molecular weight of 364.57 g/mol. Its IUPAC name is 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene.
Molecular Properties
| Compound Name | 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene |
| PubChem CID | 144633088 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene |
| SMILES | COC(C)(C)C(C)(C)O.Cc1ccc(OC2CCC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C16H24O.C7H16O2/c1-12(2)14-6-10-16(11-7-14)17-15-8-4-13(3)5-9-15;1-6(2,8)7(3,4)9-5/h4-5,8-9,12,14,16H,6-7,10-11H2,1-3H3;8H,1-5H3 |
| InChIKey | DVSWBAHMQCOBFX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene?
The IUPAC name of 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene (CID 144633088) is 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene.
What is the SMILES notation for 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene?
The canonical SMILES for 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene is COC(C)(C)C(C)(C)O.Cc1ccc(OC2CCC(C(C)C)CC2)cc1.
What is the InChIKey of 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene?
The InChIKey is DVSWBAHMQCOBFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O.C7H16O2/c1-12(2)14-6-10-16(11-7-14)17-15-8-4-13(3)5-9-15;1-6(2,8)7(3,4)9-5/h4-5,8-9,12,14,16H,6-7,10-11H2,1-3H3;8H,1-5H3.
What are the key properties of 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene?
3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene has a molecular weight of 364.57 g/mol, XLogP of 5.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,3-dimethylbutan-2-ol;1-methyl-4-(4-propan-2-ylcyclohexyl)oxybenzene is sourced from PubChem (CID 144633088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).