3-(aminomethyl)pentanoic acid

C6H13NO2 — CID 14463330

IUPAC3-(aminomethyl)pentanoic acid
SMILESCCC(CN)CC(=O)O
InChIInChI=1S/C6H13NO2/c1-2-5(4-7)3-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)
InChIKeyMVIPFBVXMASPHV-UHFFFAOYSA-N
MW131.18 g/mol
LogP0.45
Rot. Bonds4

About 3-(aminomethyl)pentanoic acid

3-(aminomethyl)pentanoic acid (PubChem CID 14463330) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is 3-(aminomethyl)pentanoic acid.

Molecular Properties

Compound Name3-(aminomethyl)pentanoic acid
PubChem CID14463330
Molecular FormulaC6H13NO2
Molecular Weight131.18 g/mol
Exact Mass131.09
IUPAC Name3-(aminomethyl)pentanoic acid
SMILESCCC(CN)CC(=O)O
InChIInChI=1S/C6H13NO2/c1-2-5(4-7)3-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)
InChIKeyMVIPFBVXMASPHV-UHFFFAOYSA-N
XLogP0.45
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.18
LogP ≤ 50.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(aminomethyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(aminomethyl)pentanoic acid?
The IUPAC name of 3-(aminomethyl)pentanoic acid (CID 14463330) is 3-(aminomethyl)pentanoic acid.
What is the SMILES notation for 3-(aminomethyl)pentanoic acid?
The canonical SMILES for 3-(aminomethyl)pentanoic acid is CCC(CN)CC(=O)O.
What is the InChIKey of 3-(aminomethyl)pentanoic acid?
The InChIKey is MVIPFBVXMASPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-5(4-7)3-6(8)9/h5H,2-4,7H2,1H3,(H,8,9).
What are the key properties of 3-(aminomethyl)pentanoic acid?
3-(aminomethyl)pentanoic acid has a molecular weight of 131.18 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)pentanoic acid is sourced from PubChem (CID 14463330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).