About tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide
tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide (PubChem CID 144633405) has the molecular formula C15H31N3O4
and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide.
Molecular Properties
| Compound Name | tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide |
| PubChem CID | 144633405 |
| Molecular Formula | C15H31N3O4 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide |
| SMILES | CC.CC(C)(C)OC(=O)NCC(=O)N1CCCC1.CNC=O |
| InChI | InChI=1S/C11H20N2O3.C2H5NO.C2H6/c1-11(2,3)16-10(15)12-8-9(14)13-6-4-5-7-13;1-3-2-4;1-2/h4-8H2,1-3H3,(H,12,15);2H,1H3,(H,3,4);1-2H3 |
| InChIKey | PVVQRSSVKNVIPS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide?
The IUPAC name of tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide (CID 144633405) is tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide.
What is the SMILES notation for tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide?
The canonical SMILES for tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide is CC.CC(C)(C)OC(=O)NCC(=O)N1CCCC1.CNC=O.
What is the InChIKey of tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide?
The InChIKey is PVVQRSSVKNVIPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3.C2H5NO.C2H6/c1-11(2,3)16-10(15)12-8-9(14)13-6-4-5-7-13;1-3-2-4;1-2/h4-8H2,1-3H3,(H,12,15);2H,1H3,(H,3,4);1-2H3.
What are the key properties of tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide?
tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide has a molecular weight of 317.43 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-oxo-2-pyrrolidin-1-ylethyl)carbamate;ethane;N-methylformamide is sourced from PubChem (CID 144633405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).