About acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane
acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane (PubChem CID 144633535) has the molecular formula C14H20BrN3O2
and a molecular weight of 342.24 g/mol. Its IUPAC name is acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane.
Molecular Properties
| Compound Name | acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane |
| PubChem CID | 144633535 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane |
| SMILES | CC.CC=O.CNNC(=O)n1ccc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H10BrN3O.C2H4O.C2H6/c1-12-13-10(15)14-5-4-7-6-8(11)2-3-9(7)14;1-2-3;1-2/h2-6,12H,1H3,(H,13,15);2H,1H3;1-2H3 |
| InChIKey | OYCGPVDZMQZYKP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane?
The IUPAC name of acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane (CID 144633535) is acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane.
What is the SMILES notation for acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane?
The canonical SMILES for acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane is CC.CC=O.CNNC(=O)n1ccc2cc(Br)ccc21.
What is the InChIKey of acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane?
The InChIKey is OYCGPVDZMQZYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O.C2H4O.C2H6/c1-12-13-10(15)14-5-4-7-6-8(11)2-3-9(7)14;1-2-3;1-2/h2-6,12H,1H3,(H,13,15);2H,1H3;1-2H3.
What are the key properties of acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane?
acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane has a molecular weight of 342.24 g/mol, XLogP of 3.33, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;5-bromo-N'-methylindole-1-carbohydrazide;ethane is sourced from PubChem (CID 144633535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).