About 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane
2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane (PubChem CID 144633691) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane.
Molecular Properties
| Compound Name | 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane |
| PubChem CID | 144633691 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane |
| SMILES | CCC.Cc1ncc(-c2ccc(C)c3c2CCC3)[nH]1.[H][H] |
| InChI | InChI=1S/C14H16N2.C3H8.H2/c1-9-6-7-13(12-5-3-4-11(9)12)14-8-15-10(2)16-14;1-3-2;/h6-8H,3-5H2,1-2H3,(H,15,16);3H2,1-2H3;1H |
| InChIKey | ANYGNHNCLZRQQX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane?
The IUPAC name of 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane (CID 144633691) is 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane.
What is the SMILES notation for 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane?
The canonical SMILES for 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane is CCC.Cc1ncc(-c2ccc(C)c3c2CCC3)[nH]1.[H][H].
What is the InChIKey of 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane?
The InChIKey is ANYGNHNCLZRQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2.C3H8.H2/c1-9-6-7-13(12-5-3-4-11(9)12)14-8-15-10(2)16-14;1-3-2;/h6-8H,3-5H2,1-2H3,(H,15,16);3H2,1-2H3;1H.
What are the key properties of 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane?
2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane has a molecular weight of 258.41 g/mol, XLogP of 4.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(7-methyl-2,3-dihydro-1H-inden-4-yl)-1H-imidazole;molecular hydrogen;propane is sourced from PubChem (CID 144633691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).