C15H24 — CID 144633888
2-(2,2-dimethylpropyl)-1-methyl-4-propylbenzene (PubChem CID 144633888) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-1-methyl-4-propylbenzene.
| Compound Name | 2-(2,2-dimethylpropyl)-1-methyl-4-propylbenzene |
|---|---|
| PubChem CID | 144633888 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-1-methyl-4-propylbenzene |
| SMILES | CCCc1ccc(C)c(CC(C)(C)C)c1 |
| InChI | InChI=1S/C15H24/c1-6-7-13-9-8-12(2)14(10-13)11-15(3,4)5/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | UXOMULJIAFHWOS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |