About 4-methoxy-N,N,2-trimethylbutanamide
4-methoxy-N,N,2-trimethylbutanamide (PubChem CID 14463400) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 4-methoxy-N,N,2-trimethylbutanamide.
Molecular Properties
| Compound Name | 4-methoxy-N,N,2-trimethylbutanamide |
| PubChem CID | 14463400 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 4-methoxy-N,N,2-trimethylbutanamide |
| SMILES | COCCC(C)C(=O)N(C)C |
| InChI | InChI=1S/C8H17NO2/c1-7(5-6-11-4)8(10)9(2)3/h7H,5-6H2,1-4H3 |
| InChIKey | RAWSCGBLDQMIIA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-N,N,2-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,N,2-trimethylbutanamide?
The IUPAC name of 4-methoxy-N,N,2-trimethylbutanamide (CID 14463400) is 4-methoxy-N,N,2-trimethylbutanamide.
What is the SMILES notation for 4-methoxy-N,N,2-trimethylbutanamide?
The canonical SMILES for 4-methoxy-N,N,2-trimethylbutanamide is COCCC(C)C(=O)N(C)C.
What is the InChIKey of 4-methoxy-N,N,2-trimethylbutanamide?
The InChIKey is RAWSCGBLDQMIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-7(5-6-11-4)8(10)9(2)3/h7H,5-6H2,1-4H3.
What are the key properties of 4-methoxy-N,N,2-trimethylbutanamide?
4-methoxy-N,N,2-trimethylbutanamide has a molecular weight of 159.23 g/mol, XLogP of 0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,N,2-trimethylbutanamide is sourced from PubChem (CID 14463400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).