C14H18BrN3S2 — CID 144634079
CID 144634079 (PubChem CID 144634079) has the molecular formula C14H18BrN3S2 and a molecular weight of 372.36 g/mol.
| Compound Name | CID 144634079 |
|---|---|
| PubChem CID | 144634079 |
| Molecular Formula | C14H18BrN3S2 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | — |
| SMILES | Brc1ccc(-c2cnc(C3CCCCN3)[nH]2)cc1.SS |
| InChI | InChI=1S/C14H16BrN3.H2S2/c15-11-6-4-10(5-7-11)13-9-17-14(18-13)12-3-1-2-8-16-12;1-2/h4-7,9,12,16H,1-3,8H2,(H,17,18);1-2H |
| InChIKey | BPUSNHYDCMRVQQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|