C22H35BrN4O3S2 — CID 144634193
ethane;methanethiol;methyl N-[(2S)-1-[(2S)-2-(7-bromo-2H-1,2,4-benzothiadiazin-3-yl)pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 144634193) has the molecular formula C22H35BrN4O3S2 and a molecular weight of 547.59 g/mol. Its IUPAC name is ethane;methanethiol;methyl N-[(2S)-1-[(2S)-2-(7-bromo-2H-1,2,4-benzothiadiazin-3-yl)pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | ethane;methanethiol;methyl N-[(2S)-1-[(2S)-2-(7-bromo-2H-1,2,4-benzothiadiazin-3-yl)pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 144634193 |
| Molecular Formula | C22H35BrN4O3S2 |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | ethane;methanethiol;methyl N-[(2S)-1-[(2S)-2-(7-bromo-2H-1,2,4-benzothiadiazin-3-yl)pyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC.CCC(C)[C@H](NC(=O)OC)C(=O)N1CCC[C@H]1C1=Nc2ccc(Br)cc2SN1.CS |
| InChI | InChI=1S/C19H25BrN4O3S.C2H6.CH4S/c1-4-11(2)16(22-19(26)27-3)18(25)24-9-5-6-14(24)17-21-13-8-7-12(20)10-15(13)28-23-17;2*1-2/h7-8,10-11,14,16H,4-6,9H2,1-3H3,(H,21,23)(H,22,26);1-2H3;2H,1H3/t11?,14-,16-;;/m0../s1 |
| InChIKey | DDUFDNAEWIWJDW-OFTBBDNOSA-N |
| XLogP | 5.42 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|