About 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole
3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole (PubChem CID 144634328) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole |
| PubChem CID | 144634328 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole |
| SMILES | CC1=CN(C)C(C2CCCN2)N1 |
| InChI | InChI=1S/C9H17N3/c1-7-6-12(2)9(11-7)8-4-3-5-10-8/h6,8-11H,3-5H2,1-2H3 |
| InChIKey | ACXLJEWABPDXCS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
The IUPAC name of 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole (CID 144634328) is 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole.
What is the SMILES notation for 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
The canonical SMILES for 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole is CC1=CN(C)C(C2CCCN2)N1.
What is the InChIKey of 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
The InChIKey is ACXLJEWABPDXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-7-6-12(2)9(11-7)8-4-3-5-10-8/h6,8-11H,3-5H2,1-2H3.
What are the key properties of 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole has a molecular weight of 167.26 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole is sourced from PubChem (CID 144634328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).