C15H17F3O4S — CID 144634367
ethane;(3-methyl-1-oxo-2,2a,7,7a-tetrahydrocyclobuta[a]inden-6-yl) trifluoromethanesulfonate (PubChem CID 144634367) has the molecular formula C15H17F3O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is ethane;(3-methyl-1-oxo-2,2a,7,7a-tetrahydrocyclobuta[a]inden-6-yl) trifluoromethanesulfonate.
| Compound Name | ethane;(3-methyl-1-oxo-2,2a,7,7a-tetrahydrocyclobuta[a]inden-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 144634367 |
| Molecular Formula | C15H17F3O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | ethane;(3-methyl-1-oxo-2,2a,7,7a-tetrahydrocyclobuta[a]inden-6-yl) trifluoromethanesulfonate |
| SMILES | CC.Cc1ccc(OS(=O)(=O)C(F)(F)F)c2c1C1CC(=O)C1C2 |
| InChI | InChI=1S/C13H11F3O4S.C2H6/c1-6-2-3-11(20-21(18,19)13(14,15)16)9-4-7-8(12(6)9)5-10(7)17;1-2/h2-3,7-8H,4-5H2,1H3;1-2H3 |
| InChIKey | UKOYBSIPMSAKMY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|