About ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide
ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide (PubChem CID 144634422) has the molecular formula C15H33N3O
and a molecular weight of 271.45 g/mol. Its IUPAC name is ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide.
Molecular Properties
| Compound Name | ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide |
| PubChem CID | 144634422 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide |
| SMILES | C/N=C(\N)[C@@H]1CCCN1C(=O)CC(C)C.CC.CC |
| InChI | InChI=1S/C11H21N3O.2C2H6/c1-8(2)7-10(15)14-6-4-5-9(14)11(12)13-3;2*1-2/h8-9H,4-7H2,1-3H3,(H2,12,13);2*1-2H3/t9-;;/m0../s1 |
| InChIKey | SOZGJTGMPWTJOZ-WWPIYYJJSA-N |
| XLogP | 3.06 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide?
The IUPAC name of ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide (CID 144634422) is ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide.
What is the SMILES notation for ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide?
The canonical SMILES for ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide is C/N=C(\N)[C@@H]1CCCN1C(=O)CC(C)C.CC.CC.
What is the InChIKey of ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide?
The InChIKey is SOZGJTGMPWTJOZ-WWPIYYJJSA-N. The full InChI is InChI=1S/C11H21N3O.2C2H6/c1-8(2)7-10(15)14-6-4-5-9(14)11(12)13-3;2*1-2/h8-9H,4-7H2,1-3H3,(H2,12,13);2*1-2H3/t9-;;/m0../s1.
What are the key properties of ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide?
ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide has a molecular weight of 271.45 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S)-N'-methyl-1-(3-methylbutanoyl)pyrrolidine-2-carboximidamide is sourced from PubChem (CID 144634422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).