About 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane
6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane (PubChem CID 144634443) has the molecular formula C18H32
and a molecular weight of 248.45 g/mol. Its IUPAC name is 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane.
Molecular Properties
| Compound Name | 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane |
| PubChem CID | 144634443 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane |
| SMILES | C=C(C)C1=C(C(=C)C)CC2(CCC2)C1.CC.CC |
| InChI | InChI=1S/C14H20.2C2H6/c1-10(2)12-8-14(6-5-7-14)9-13(12)11(3)4;2*1-2/h1,3,5-9H2,2,4H3;2*1-2H3 |
| InChIKey | BXERJAQUQKJRMK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane?
The IUPAC name of 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane (CID 144634443) is 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane.
What is the SMILES notation for 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane?
The canonical SMILES for 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane is C=C(C)C1=C(C(=C)C)CC2(CCC2)C1.CC.CC.
What is the InChIKey of 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane?
The InChIKey is BXERJAQUQKJRMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.2C2H6/c1-10(2)12-8-14(6-5-7-14)9-13(12)11(3)4;2*1-2/h1,3,5-9H2,2,4H3;2*1-2H3.
What are the key properties of 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane?
6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane has a molecular weight of 248.45 g/mol, XLogP of 6.45, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(prop-1-en-2-yl)spiro[3.4]oct-6-ene;ethane is sourced from PubChem (CID 144634443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).