About S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane
S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane (PubChem CID 144635021) has the molecular formula C21H22O3S
and a molecular weight of 354.47 g/mol. Its IUPAC name is S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane.
Molecular Properties
| Compound Name | S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane |
| PubChem CID | 144635021 |
| Molecular Formula | C21H22O3S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane |
| SMILES | CC(=O)Sc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1.CCC |
| InChI | InChI=1S/C18H14O3S.C3H8/c1-12(19)22-15-9-7-13(8-10-15)16-11-21-18(20)17(16)14-5-3-2-4-6-14;1-3-2/h2-10H,11H2,1H3;3H2,1-2H3 |
| InChIKey | WKFAUXWKCVFYKT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane?
The IUPAC name of S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane (CID 144635021) is S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane.
What is the SMILES notation for S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane?
The canonical SMILES for S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane is CC(=O)Sc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1.CCC.
What is the InChIKey of S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane?
The InChIKey is WKFAUXWKCVFYKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O3S.C3H8/c1-12(19)22-15-9-7-13(8-10-15)16-11-21-18(20)17(16)14-5-3-2-4-6-14;1-3-2/h2-10H,11H2,1H3;3H2,1-2H3.
What are the key properties of S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane?
S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane has a molecular weight of 354.47 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] ethanethioate;propane is sourced from PubChem (CID 144635021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).