C17H18N2O — CID 144635059
3-(1,2,3,4,6,7-hexahydro-[1]benzofuro[2,3-c]pyridin-1-yl)aniline (PubChem CID 144635059) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(1,2,3,4,6,7-hexahydro-[1]benzofuro[2,3-c]pyridin-1-yl)aniline.
| Compound Name | 3-(1,2,3,4,6,7-hexahydro-[1]benzofuro[2,3-c]pyridin-1-yl)aniline |
|---|---|
| PubChem CID | 144635059 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-(1,2,3,4,6,7-hexahydro-[1]benzofuro[2,3-c]pyridin-1-yl)aniline |
| SMILES | Nc1cccc(C2NCCc3c2oc2c3=CCCC=2)c1 |
| InChI | InChI=1S/C17H18N2O/c18-12-5-3-4-11(10-12)16-17-14(8-9-19-16)13-6-1-2-7-15(13)20-17/h3-7,10,16,19H,1-2,8-9,18H2 |
| InChIKey | AASDGOHMWLBIEO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|