C15H22FNO — CID 144635074
(2Z,4E)-4-[[[(1E,3E)-3-ethyl-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol (PubChem CID 144635074) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is (2Z,4E)-4-[[[(1E,3E)-3-ethyl-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol.
| Compound Name | (2Z,4E)-4-[[[(1E,3E)-3-ethyl-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 144635074 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (2Z,4E)-4-[[[(1E,3E)-3-ethyl-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol |
| SMILES | C=C/C(F)=C(\C=C\NCC(/C=C\CO)=C/C)CC |
| InChI | InChI=1S/C15H22FNO/c1-4-13(8-7-11-18)12-17-10-9-14(5-2)15(16)6-3/h4,6-10,17-18H,3,5,11-12H2,1-2H3/b8-7-,10-9+,13-4+,15-14+ |
| InChIKey | PEYURGACBSMAHZ-LDAVJMNPSA-N |
| XLogP | 3.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|