C25H39F3N4O2 — CID 144635419
1,1-dimethylhydrazine;N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline;formaldehyde (PubChem CID 144635419) has the molecular formula C25H39F3N4O2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 1,1-dimethylhydrazine;N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline;formaldehyde.
| Compound Name | 1,1-dimethylhydrazine;N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline;formaldehyde |
|---|---|
| PubChem CID | 144635419 |
| Molecular Formula | C25H39F3N4O2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1,1-dimethylhydrazine;N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline;formaldehyde |
| SMILES | C=C/C=C\C(=C/C(C)C(CCC)=NOCc1c(C)cccc1NC)C(F)(F)F.C=O.CN(C)N |
| InChI | InChI=1S/C22H29F3N2O.C2H8N2.CH2O/c1-6-8-12-18(22(23,24)25)14-17(4)20(10-7-2)27-28-15-19-16(3)11-9-13-21(19)26-5;1-4(2)3;1-2/h6,8-9,11-14,17,26H,1,7,10,15H2,2-5H3;3H2,1-2H3;1H2/b12-8-,18-14+,27-20?;; |
| InChIKey | PLMZHCAPXMLRFZ-NCABQATJSA-N |
| XLogP | 5.81 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|