C24H29N5O2 — CID 144635535
3-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]-1-diazenyl-1-methylurea (PubChem CID 144635535) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]-1-diazenyl-1-methylurea.
| Compound Name | 3-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]-1-diazenyl-1-methylurea |
|---|---|
| PubChem CID | 144635535 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 3-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]-1-diazenyl-1-methylurea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1cccc(C2CC2)c1CON=C(C)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H29N5O2/c1-16(19-10-5-8-17-7-3-4-9-20(17)19)27-31-15-22-21(18-13-14-18)11-6-12-23(22)26-24(30)29(2)28-25/h5-6,8,10-12,18,25H,3-4,7,9,13-15H2,1-2H3,(H,26,30)/b27-16?,28-25+ |
| InChIKey | VUGDSLAWBXJKHK-CFFORMKJSA-N |
| XLogP | 5.79 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|