C22H27N5O2 — CID 144635561
1-diazenyl-1-methyl-3-[3-methyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]urea (PubChem CID 144635561) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-diazenyl-1-methyl-3-[3-methyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]urea.
| Compound Name | 1-diazenyl-1-methyl-3-[3-methyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]urea |
|---|---|
| PubChem CID | 144635561 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-diazenyl-1-methyl-3-[3-methyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylideneamino]oxymethyl]phenyl]urea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1cccc(C)c1CON=C(C)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H27N5O2/c1-15-8-6-13-21(24-22(28)27(3)26-23)20(15)14-29-25-16(2)18-12-7-10-17-9-4-5-11-19(17)18/h6-8,10,12-13,23H,4-5,9,11,14H2,1-3H3,(H,24,28)/b25-16?,26-23+ |
| InChIKey | PGJSQMTWJRNJAX-QDCAOOORSA-N |
| XLogP | 5.22 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|