C14H22N2O — CID 144635944
4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 144635944) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 144635944 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | C=C(/C=C\C=C/C)C1(C(N)=O)CCN(C)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-4-5-6-7-12(2)14(13(15)17)8-10-16(3)11-9-14/h4-7H,2,8-11H2,1,3H3,(H2,15,17)/b5-4-,7-6- |
| InChIKey | VYDOMGCXCILIJZ-RZSVFLSASA-N |
| XLogP | 1.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|