C22H19ClF2O5S — CID 144636270
(7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluorospiro[6a,8,9,10-tetrahydro-6H-benzo[c]chromene-7,3'-oxolane]-2'-one (PubChem CID 144636270) has the molecular formula C22H19ClF2O5S and a molecular weight of 468.91 g/mol. Its IUPAC name is (7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluorospiro[6a,8,9,10-tetrahydro-6H-benzo[c]chromene-7,3'-oxolane]-2'-one.
| Compound Name | (7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluorospiro[6a,8,9,10-tetrahydro-6H-benzo[c]chromene-7,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 144636270 |
| Molecular Formula | C22H19ClF2O5S |
| Molecular Weight | 468.91 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | (7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluorospiro[6a,8,9,10-tetrahydro-6H-benzo[c]chromene-7,3'-oxolane]-2'-one |
| SMILES | O=C1OCC[C@]12CCC[C@@]1(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC21 |
| InChI | InChI=1S/C22H19ClF2O5S/c23-13-2-4-14(5-3-13)31(27,28)22-9-1-8-21(10-11-29-20(21)26)17(22)12-30-19-16(25)7-6-15(24)18(19)22/h2-7,17H,1,8-12H2/t17?,21-,22-/m0/s1 |
| InChIKey | AZSDCDNUQDIYHT-VNQANMTISA-N |
| XLogP | 4.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |