C17H29NO — CID 144636496
ethane;2-methylbutanamide;1,2,3,4-tetrahydronaphthalene (PubChem CID 144636496) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;2-methylbutanamide;1,2,3,4-tetrahydronaphthalene.
| Compound Name | ethane;2-methylbutanamide;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 144636496 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | ethane;2-methylbutanamide;1,2,3,4-tetrahydronaphthalene |
| SMILES | CC.CCC(C)C(N)=O.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.C5H11NO.C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-4(2)5(6)7;1-2/h1-2,5-6H,3-4,7-8H2;4H,3H2,1-2H3,(H2,6,7);1-2H3 |
| InChIKey | HTNULGCFABONJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |