C14H21N3O4 — CID 144636845
tert-butyl carbamate;methyl (E)-3-(6-amino-3-pyridinyl)prop-2-enoate (PubChem CID 144636845) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butyl carbamate;methyl (E)-3-(6-amino-3-pyridinyl)prop-2-enoate.
| Compound Name | tert-butyl carbamate;methyl (E)-3-(6-amino-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 144636845 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | tert-butyl carbamate;methyl (E)-3-(6-amino-3-pyridinyl)prop-2-enoate |
| SMILES | CC(C)(C)OC(N)=O.COC(=O)/C=C/c1ccc(N)nc1 |
| InChI | InChI=1S/C9H10N2O2.C5H11NO2/c1-13-9(12)5-3-7-2-4-8(10)11-6-7;1-5(2,3)8-4(6)7/h2-6H,1H3,(H2,10,11);1-3H3,(H2,6,7)/b5-3+; |
| InChIKey | CRXNONROVLETIF-WGCWOXMQSA-N |
| XLogP | 1.73 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|