C28H29ClN2O3S — CID 144636862
N-[[5-(5-acetylthiophen-2-yl)-7-chloro-2,3-dihydro-1-benzofuran-2-yl]methyl]formamide;buta-1,3-diene;3-[(E)-prop-1-enyl]pyridine (PubChem CID 144636862) has the molecular formula C28H29ClN2O3S and a molecular weight of 509.07 g/mol. Its IUPAC name is N-[[5-(5-acetylthiophen-2-yl)-7-chloro-2,3-dihydro-1-benzofuran-2-yl]methyl]formamide;buta-1,3-diene;3-[(E)-prop-1-enyl]pyridine.
| Compound Name | N-[[5-(5-acetylthiophen-2-yl)-7-chloro-2,3-dihydro-1-benzofuran-2-yl]methyl]formamide;buta-1,3-diene;3-[(E)-prop-1-enyl]pyridine |
|---|---|
| PubChem CID | 144636862 |
| Molecular Formula | C28H29ClN2O3S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N-[[5-(5-acetylthiophen-2-yl)-7-chloro-2,3-dihydro-1-benzofuran-2-yl]methyl]formamide;buta-1,3-diene;3-[(E)-prop-1-enyl]pyridine |
| SMILES | C/C=C/c1cccnc1.C=CC=C.CC(=O)c1ccc(-c2cc(Cl)c3c(c2)CC(CNC=O)O3)s1 |
| InChI | InChI=1S/C16H14ClNO3S.C8H9N.C4H6/c1-9(20)14-2-3-15(22-14)10-4-11-5-12(7-18-8-19)21-16(11)13(17)6-10;1-2-4-8-5-3-6-9-7-8;1-3-4-2/h2-4,6,8,12H,5,7H2,1H3,(H,18,19);2-7H,1H3;3-4H,1-2H2/b;4-2+; |
| InChIKey | JHCLXNDCXHGOOE-ADXGFCJISA-N |
| XLogP | 6.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|