C30H32N4O4 — CID 144637217
4-[(E)-1-[[1-[3-(dimethylamino)-2-oxopropyl]-2,3-dihydroindol-5-yl]amino]-1-phenylprop-1-en-2-yl]-3-formamidobenzoic acid (PubChem CID 144637217) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is 4-[(E)-1-[[1-[3-(dimethylamino)-2-oxopropyl]-2,3-dihydroindol-5-yl]amino]-1-phenylprop-1-en-2-yl]-3-formamidobenzoic acid.
| Compound Name | 4-[(E)-1-[[1-[3-(dimethylamino)-2-oxopropyl]-2,3-dihydroindol-5-yl]amino]-1-phenylprop-1-en-2-yl]-3-formamidobenzoic acid |
|---|---|
| PubChem CID | 144637217 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 4-[(E)-1-[[1-[3-(dimethylamino)-2-oxopropyl]-2,3-dihydroindol-5-yl]amino]-1-phenylprop-1-en-2-yl]-3-formamidobenzoic acid |
| SMILES | C/C(=C(\Nc1ccc2c(c1)CCN2CC(=O)CN(C)C)c1ccccc1)c1ccc(C(=O)O)cc1NC=O |
| InChI | InChI=1S/C30H32N4O4/c1-20(26-11-9-23(30(37)38)16-27(26)31-19-35)29(21-7-5-4-6-8-21)32-24-10-12-28-22(15-24)13-14-34(28)18-25(36)17-33(2)3/h4-12,15-16,19,32H,13-14,17-18H2,1-3H3,(H,31,35)(H,37,38)/b29-20+ |
| InChIKey | KZVDJZYHBUFVRU-ZTKZIYFRSA-N |
| XLogP | 4.45 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|