C21H26N4OS — CID 144637776
butylbenzene;1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carbaldehyde (PubChem CID 144637776) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is butylbenzene;1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carbaldehyde.
| Compound Name | butylbenzene;1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 144637776 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | butylbenzene;1-([1,2,5]thiadiazolo[3,4-b]pyridin-7-yl)piperidine-4-carbaldehyde |
| SMILES | CCCCc1ccccc1.O=CC1CCN(c2ccnc3nsnc23)CC1 |
| InChI | InChI=1S/C11H12N4OS.C10H14/c16-7-8-2-5-15(6-3-8)9-1-4-12-11-10(9)13-17-14-11;1-2-3-7-10-8-5-4-6-9-10/h1,4,7-8H,2-3,5-6H2;4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | JMJPKFJQMCCDJF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|