C21H36O — CID 144639029
6-[[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]methyl]hept-6-enal (PubChem CID 144639029) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 6-[[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]methyl]hept-6-enal.
| Compound Name | 6-[[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]methyl]hept-6-enal |
|---|---|
| PubChem CID | 144639029 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 6-[[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]methyl]hept-6-enal |
| SMILES | C=C(CCCCC=O)C[C@H]1CCCC1/C=C/CCCCCC |
| InChI | InChI=1S/C21H36O/c1-3-4-5-6-7-10-14-20-15-12-16-21(20)18-19(2)13-9-8-11-17-22/h10,14,17,20-21H,2-9,11-13,15-16,18H2,1H3/b14-10+/t20?,21-/m1/s1 |
| InChIKey | XTRTZPOGWKVKRH-CZKTVDAHSA-N |
| XLogP | 6.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|