C15H15N3 — CID 144639146
6-[(2S)-2-methylpyrrolidin-1-yl]isoquinoline-1-carbonitrile (PubChem CID 144639146) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 6-[(2S)-2-methylpyrrolidin-1-yl]isoquinoline-1-carbonitrile.
| Compound Name | 6-[(2S)-2-methylpyrrolidin-1-yl]isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 144639146 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6-[(2S)-2-methylpyrrolidin-1-yl]isoquinoline-1-carbonitrile |
| SMILES | C[C@H]1CCCN1c1ccc2c(C#N)nccc2c1 |
| InChI | InChI=1S/C15H15N3/c1-11-3-2-8-18(11)13-4-5-14-12(9-13)6-7-17-15(14)10-16/h4-7,9,11H,2-3,8H2,1H3/t11-/m0/s1 |
| InChIKey | ZHTQBZMKHQYZHQ-NSHDSACASA-N |
| XLogP | 3.10 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |