C16H16S — CID 144639190
2-methyl-3-propylbenzo[f][1]benzothiole (PubChem CID 144639190) has the molecular formula C16H16S and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-methyl-3-propylbenzo[f][1]benzothiole.
| Compound Name | 2-methyl-3-propylbenzo[f][1]benzothiole |
|---|---|
| PubChem CID | 144639190 |
| Molecular Formula | C16H16S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-methyl-3-propylbenzo[f][1]benzothiole |
| SMILES | CCCc1c(C)sc2cc3ccccc3cc12 |
| InChI | InChI=1S/C16H16S/c1-3-6-14-11(2)17-16-10-13-8-5-4-7-12(13)9-15(14)16/h4-5,7-10H,3,6H2,1-2H3 |
| InChIKey | DWGSEQNYGXUIBJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |